| Product Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-oxobutanoic acid |
| CAS No. | 175136-33-1 |
| InChI | InChI=1/C13H14O5/c14-10(3-5-13(15)16)9-2-4-11-12(8-9)18-7-1-6-17-11/h2,4,8H,1,3,5-7H2,(H,15,16) |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.2473 |
| Density | 1.281g/cm3 |
| Melting point | 145℃ |
| Boiling point | 482.3°C at 760 mmHg |
| Flash point | 188°C |
| Refractive index | 1.553 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-33-1 4-(3,4-dihydro-2h-1,5-benzodioxepin-7-yl)-4-oxobutanoic acid
service@apichina.com