| Product Name | 4-(2-thienyl)benzylamine |
| CAS No. | 203436-48-0 |
| Synonyms | 1-(4-thiophen-2-ylphenyl)methanamine; 4-(1,3-oxazol-5-yl)benzoic acid |
| InChI | InChI=1/C10H7NO3/c12-10(13)8-3-1-7(2-4-8)9-5-11-6-14-9/h1-6H,(H,12,13) |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.1675 |
| Density | 1.32g/cm3 |
| Boiling point | 390.3°C at 760 mmHg |
| Flash point | 189.8°C |
| Refractive index | 1.587 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
203436-48-0 4-(2-thienyl)benzylamine
service@apichina.com