| Product Name | 4-(2-Thienoyl)butyric acid |
| CAS No. | 22971-62-6 |
| Synonyms | 5-oxo-5-(thiophen-2-yl)pentanoic acid; 5-oxo-5-(2-thienyl)valeric acid |
| InChI | InChI=1/C9H10O3S/c10-7(3-1-5-9(11)12)8-4-2-6-13-8/h2,4,6H,1,3,5H2,(H,11,12) |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.2389 |
| Density | 1.282g/cm3 |
| Boiling point | 407.8°C at 760 mmHg |
| Flash point | 200.5°C |
| Refractive index | 1.561 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22971-62-6 4-(2-thienoyl)butyric acid
service@apichina.com