| Product Name | 4-(2-Thiazolylazo)resorcinol |
| CAS No. | 2246-46-0 |
| Synonyms | 3-hydroxy-4-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,5-dien-1-one |
| InChI | InChI=1/C9H7N3O2S/c13-6-1-2-7(8(14)5-6)11-12-9-10-3-4-15-9/h1-5,14H,(H,10,12) |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.2358 |
| Density | 1.53g/cm3 |
| Melting point | 205-210℃ |
| Boiling point | 402.9°C at 760 mmHg |
| Flash point | 197.4°C |
| Refractive index | 1.734 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2246-46-0 4-(2-thiazolylazo)resorcinol
service@apichina.com