| Product Name | 4-(2-Pyridylazo)resorcinol monosodium salt hydrate |
| CAS No. | 13311-52-9 |
| Synonyms | sodium (6E)-3-oxo-6-[2-(pyridin-2-yl)hydrazinylidene]cyclohexa-1,4-dien-1-olate |
| InChI | InChI=1/C11H9N3O2.Na/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h1-7,16H,(H,12,14);/q;+1/p-1/b13-9+; |
| Molecular Formula | C11H8N3NaO2 |
| Molecular Weight | 237.1899 |
| Boiling point | 399.2°C at 760 mmHg |
| Flash point | 195.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13311-52-9 4-(2-pyridylazo)resorcinol monosodium salt hydrate
service@apichina.com