| Product Name | 4-(2-Methylphenyl)-3-thiosemicarbazide |
| CAS No. | 614-10-8 |
| Synonyms | 4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.258 |
| Density | 1.27g/cm3 |
| Boiling point | 295.9°C at 760 mmHg |
| Flash point | 132.8°C |
| Refractive index | 1.699 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
614-10-8 4-(2-methylphenyl)-3-thiosemicarbazide
service@apichina.com