| Product Name | 4-(2-methyl-4-nitro-1H-imidazol-1-yl)butan-2-one |
| CAS No. | 126664-28-6 |
| InChI | InChI=1/C8H11N3O3/c1-6(12)3-4-10-5-8(11(13)14)9-7(10)2/h5H,3-4H2,1-2H3 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.1912 |
| Density | 1.32g/cm3 |
| Melting point | 98℃ |
| Boiling point | 401.1°C at 760 mmHg |
| Flash point | 196.4°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
126664-28-6 4-(2-methyl-4-nitro-1h-imidazol-1-yl)butan-2-one
service@apichina.com