| Product Name | 4-[(2-furylmethyl)thio]-3-nitrobenzaldehyde |
| CAS No. | 175278-53-2 |
| Synonyms | 4-[(furan-2-ylmethyl)sulfanyl]-3-nitrobenzaldehyde |
| InChI | InChI=1/C12H9NO4S/c14-7-9-3-4-12(11(6-9)13(15)16)18-8-10-2-1-5-17-10/h1-7H,8H2 |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.2692 |
| Density | 1.4g/cm3 |
| Melting point | 153℃ |
| Boiling point | 413.4°C at 760 mmHg |
| Flash point | 203.8°C |
| Refractive index | 1.638 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-53-2 4-[(2-furylmethyl)thio]-3-nitrobenzaldehyde
service@apichina.com