| Product Name | 4-[(2-ethoxy-3,4-dioxocyclobut-1-enyl)amino]benzoic acid |
| CAS No. | 175204-30-5 |
| Synonyms | 4-[(2-ethoxy-3,4-dioxocyclobut-1-en-1-yl)amino]benzoic acid |
| InChI | InChI=1/C13H11NO5/c1-2-19-12-9(10(15)11(12)16)14-8-5-3-7(4-6-8)13(17)18/h3-6,14H,2H2,1H3,(H,17,18) |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.2301 |
| Density | 1.44g/cm3 |
| Melting point | 258℃ |
| Boiling point | 469.4°C at 760 mmHg |
| Flash point | 237.7°C |
| Refractive index | 1.621 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-30-5 4-[(2-ethoxy-3,4-dioxocyclobut-1-enyl)amino]benzoic acid
service@apichina.com