| Product Name | 4-(2-Chlorophenyl)-3-thiosemicarbazide |
| CAS No. | 42135-75-1 |
| Synonyms | N-(2-chlorophenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C7H8ClN3S/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
| Molecular Formula | C7H8ClN3S |
| Molecular Weight | 201.6765 |
| Density | 1.458g/cm3 |
| Boiling point | 312.9°C at 760 mmHg |
| Flash point | 143°C |
| Refractive index | 1.729 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
42135-75-1 4-(2-chlorophenyl)-3-thiosemicarbazide
service@apichina.com