| Product Name | 4-(2-Chloroethyl)acetophenone |
| CAS No. | 69614-95-5 |
| Synonyms | 4'-(beta-Chloroethyl)acetophenone; 1-[4-(2-chloroethyl)phenyl]ethanone |
| InChI | InChI=1/C10H11ClO/c1-8(12)10-4-2-9(3-5-10)6-7-11/h2-5H,6-7H2,1H3 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.6467 |
| Density | 1.105g/cm3 |
| Boiling point | 297°C at 760 mmHg |
| Flash point | 149.8°C |
| Refractive index | 1.525 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
69614-95-5 4-(2-chloroethyl)acetophenone
service@apichina.com