| Product Name | 4-(2-Carboxyethyl)benzeneboronic acid |
| CAS No. | 166316-48-9 |
| Synonyms | 3-(4-Boronophenyl)propionic acid~4-(2-Carboxyethyl)phenylboronic acid; 3-[4-(dihydroxyboranyl)phenyl]propanoic acid |
| InChI | InChI=1/C9H11BO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-2,4-5,13-14H,3,6H2,(H,11,12) |
| Molecular Formula | C9H11BO4 |
| Molecular Weight | 193.9922 |
| Density | 1.28g/cm3 |
| Boiling point | 419.2°C at 760 mmHg |
| Flash point | 207.3°C |
| Refractive index | 1.56 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
166316-48-9 4-(2-carboxyethyl)benzeneboronic acid
service@apichina.com