| Product Name | 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile |
| CAS No. | 60207-22-9 |
| InChI | InChI=1/C11H10BrNO2/c12-8-11(14-5-6-15-11)10-3-1-9(7-13)2-4-10/h1-4H,5-6,8H2 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.1066 |
| Density | 1.54g/cm3 |
| Melting point | 96℃ |
| Boiling point | 379.6°C at 760 mmHg |
| Flash point | 183.4°C |
| Refractive index | 1.596 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
60207-22-9 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile
service@apichina.com