| Product Name | 4-(2,6-Dimethylphenyl)-3-thiosemicarbazide |
| CAS No. | 71058-35-0 |
| Synonyms | 4-(2,6-Dimethylphenyl)-3-____________; N-(2,6-dimethylphenyl)hydrazinecarbothioamide; 2-(2,6-dimethylphenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C9H13N3S/c1-6-4-3-5-7(2)8(6)11-12-9(10)13/h3-5,11H,1-2H3,(H3,10,12,13) |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.2846 |
| Density | 1.228g/cm3 |
| Boiling point | 304.4°C at 760 mmHg |
| Flash point | 137.9°C |
| Refractive index | 1.678 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
71058-35-0 4-(2,6-dimethylphenyl)-3-thiosemicarbazide
service@apichina.com