| Product Name | 4-(2,6-Dimethylheptyl)phenol(O and P) |
| CAS No. | 25154-52-3;1300-16-9 |
| Synonyms | 2,6-dimethyl-4-heptylphenol,(oandp); hydroxylno.253; monononylphenol; n-nonylphenol; nonyl; nonyl-pheno; nonylphenol(isomermixture); nonylphenol; Nonyl phenol; potassium 2-nonylphenolate; strontium bis(2-nonylphenolate); sodium 2-nonylphenolate; 4-(2,6-dimethylheptyl)phenol; 4-(1,3,5-trimethylhexyl)phenol |
| InChI | InChI=1/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.3505 |
| Density | 0.926g/cm3 |
| Melting point | -8℃ |
| Boiling point | 306.7°C at 760 mmHg |
| Flash point | 156.2°C |
| Water solubility | 6 mg l-1 |
| Refractive index | 1.5 |
25154-52-3;1300-16-9 4-(2,6-dimethylheptyl)phenol(o and p)
service@apichina.com