| Product Name | 4-[2-(4-Morpholino)ethyl]-3-thiosemicarbazide |
| CAS No. | 77644-45-2 |
| Synonyms | 4-(2-Morpholinoethyl)-3-thiosemicarbazide; N-[2-(morpholin-4-yl)ethyl]hydrazinecarbothioamide |
| InChI | InChI=1/C7H16N4OS/c8-10-7(13)9-1-2-11-3-5-12-6-4-11/h1-6,8H2,(H2,9,10,13) |
| Molecular Formula | C7H16N4OS |
| Molecular Weight | 204.2931 |
| Density | 1.209g/cm3 |
| Boiling point | 340.6°C at 760 mmHg |
| Flash point | 159.8°C |
| Refractive index | 1.572 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
77644-45-2 4-[2-(4-morpholino)ethyl]-3-thiosemicarbazide
service@apichina.com