| Product Name | 4-[2-(4-Fluorophenyl)ethyl]-4-piperidone |
| CAS No. | 23808-43-7 |
| Synonyms | 1-[2-(4-Fluorophenyl)ethyl]-4-piperidone; 1-(4-Fluorophenethyl)-4-piperidone; 1-[2-(4-fluorophenyl)ethyl]piperidin-4-one |
| InChI | InChI=1/C13H16FNO/c14-12-3-1-11(2-4-12)5-8-15-9-6-13(16)7-10-15/h1-4H,5-10H2 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.2706 |
| Density | 1.126g/cm3 |
| Boiling point | 336.2°C at 760 mmHg |
| Flash point | 157.1°C |
| Refractive index | 1.528 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
23808-43-7 4-[2-(4-fluorophenyl)ethyl]-4-piperidone
service@apichina.com