| Sales Email | Service@apichina.com |
| CAS No. | 146653-57-8 |
| Product Name | 4-[2-(3-methoxyphenyl)-2-oxoethyl]benzonitrile |
| InChI | InChI=1/C16H13NO2/c1-19-15-4-2-3-14(10-15)16(18)9-12-5-7-13(11-17)8-6-12/h2-8,10H,9H2,1H3 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.2799 |
| Density | 1.18g/cm3 |
| Melting point | 100℃ |
| Boiling point | 426.3°C at 760 mmHg |
| Flash point | 186.3°C |
| Refractive index | 1.592 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
