| Product Name | 4-(1H-pyrazol-1-yl)benzoyl chloride |
| CAS No. | 220461-83-6 |
| Synonyms | 4-pyrazol-1-ylbenzoyl chloride |
| InChI | InChI=1/C10H7ClN2O/c11-10(14)8-2-4-9(5-3-8)13-7-1-6-12-13/h1-7H |
| Molecular Formula | C10H7ClN2O |
| Molecular Weight | 206.6284 |
| Density | 1.303g/cm3 |
| Melting point | 118℃ |
| Boiling point | 319.861°C at 760 mmHg |
| Flash point | 147.247°C |
| Refractive index | 1.624 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
220461-83-6 4-(1h-pyrazol-1-yl)benzoyl chloride
service@apichina.com