| Product Name | 4-(1H-1,2,4-triazol-1-yl)benzoic acid |
| CAS No. | 162848-16-0 |
| Synonyms | 4-(1H-1,2,4-triazol-1-yl)benzoate |
| InChI | InChI=1/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-6-10-5-11-12/h1-6H,(H,13,14)/p-1 |
| Molecular Formula | C9H6N3O2 |
| Molecular Weight | 188.1634 |
| Melting point | 310℃ |
| Boiling point | 424.1°C at 760 mmHg |
| Flash point | 210.3°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
162848-16-0 4-(1h-1,2,4-triazol-1-yl)benzoic acid
service@apichina.com