| Product Name | 4-(1-Pyrrolidino)acetophenone |
| CAS No. | 21557-09-5 |
| Synonyms | 1-[4-(pyrrolidin-1-yl)phenyl]ethanone |
| InChI | InChI=1/C12H15NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.2536 |
| Density | 1.078g/cm3 |
| Boiling point | 342.7°C at 760 mmHg |
| Flash point | 136.5°C |
| Refractive index | 1.556 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21557-09-5 4-(1-pyrrolidino)acetophenone
service@apichina.com