| Product Name | 4-(1-Bromoethyl)benzoic acid |
| CAS No. | 113023-73-7 |
| InChI | InChI=1/C9H9BrO2/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6H,1H3,(H,11,12) |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.0706 |
| Density | 1.54g/cm3 |
| Boiling point | 324.3°C at 760 mmHg |
| Flash point | 150°C |
| Refractive index | 1.594 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
113023-73-7 4-(1-bromoethyl)benzoic acid
service@apichina.com