| Product Name | 4-(1-adamantyl)-6-hydrazino-1,3,5-trazin-2-amine |
| CAS No. | 175204-75-8 |
| Synonyms | 4-hydrazino-6-tricyclo[3.3.1.1~3,7~]dec-1-yl-1,3,5-triazin-2-amine |
| InChI | InChI=1/C13H20N6/c14-11-16-10(17-12(18-11)19-15)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6,15H2,(H3,14,16,17,18,19) |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.3381 |
| Density | 1.392g/cm3 |
| Melting point | 265℃ |
| Boiling point | 522.2°C at 760 mmHg |
| Flash point | 269.6°C |
| Refractive index | 1.716 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-75-8 4-(1-adamantyl)-6-hydrazino-1,3,5-trazin-2-amine
service@apichina.com