| Product Name | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate |
| CAS No. | 321309-41-5 |
| Synonyms | 5-(4-isothiocyanatophenyl)-1,3-oxazole |
| InChI | InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H |
| Molecular Formula | C10H6N2OS |
| Molecular Weight | 202.2324 |
| Density | 1.25g/cm3 |
| Melting point | 131℃ |
| Boiling point | 367°C at 760 mmHg |
| Flash point | 175.8°C |
| Refractive index | 1.644 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
321309-41-5 4-(1,3-oxazol-5-yl)phenyl isothiocyanate
service@apichina.com