| Product Name | 4-(1,3-Dithiolan-2-yl)phenol |
| CAS No. | 22068-49-1 |
| Synonyms | Phenol, p-(1,3-dithiolan-2-yl)-; 1,3-Dithiolane, 2-(4-hydroxyphenyl)-; 4-19-00-00740 (Beilstein Handbook Reference); BRN 0141157; NSC 132849; p-(1,3-Dithiolan-2-yl)phenol |
| InChI | InChI=1/C9H10OS2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4,9-10H,5-6H2 |
| Molecular Formula | C9H10OS2 |
| Molecular Weight | 198.3051 |
| Density | 1.319g/cm3 |
| Melting point | 117-119℃ |
| Boiling point | 376.4°C at 760 mmHg |
| Flash point | 183°C |
| Refractive index | 1.675 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
22068-49-1 4-(1,3-dithiolan-2-yl)phenol
service@apichina.com