| Product Name | 4-(1,3-dithiolan-2-yl)benzene-1-carbothioamide |
| CAS No. | 175204-52-1 |
| Synonyms | 4-(1,3-dithiolan-2-yl)benzenecarbothioamide |
| InChI | InChI=1/C10H11NS3/c11-9(12)7-1-3-8(4-2-7)10-13-5-6-14-10/h1-4,10H,5-6H2,(H2,11,12) |
| Molecular Formula | C10H11NS3 |
| Molecular Weight | 241.396 |
| Density | 1.352g/cm3 |
| Melting point | 174℃ |
| Boiling point | 418.8°C at 760 mmHg |
| Flash point | 207.1°C |
| Refractive index | 1.724 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175204-52-1 4-(1,3-dithiolan-2-yl)benzene-1-carbothioamide
service@apichina.com