| Product Name | (3S)-(-)-3-Acetamidopyrrolidine |
| CAS No. | 114636-31-6 |
| Synonyms | N-[(3R)-pyrrolidin-3-yl]acetamide; N-[(3S)-pyrrolidin-3-yl]acetamide |
| InChI | InChI=1/C6H12N2O/c1-5(9)8-6-2-3-7-4-6/h6-7H,2-4H2,1H3,(H,8,9)/t6-/m0/s1 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.1723 |
| Density | 1.04g/cm3 |
| Boiling point | 306.8°C at 760 mmHg |
| Flash point | 150.8°C |
| Refractive index | 1.485 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
114636-31-6 (3s)-(-)-3-acetamidopyrrolidine
service@apichina.com