| Product Name | (3R,5S)-3-acetyl-5-butyldihydrofuran-2(3H)-one |
| CAS No. | 40010-99-9 |
| InChI | InChI=1/C10H16O3/c1-3-4-5-8-6-9(7(2)11)10(12)13-8/h8-9H,3-6H2,1-2H3/t8-,9+/m0/s1 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.2322 |
| Density | 1.034g/cm3 |
| Boiling point | 319.8°C at 760 mmHg |
| Flash point | 141°C |
| Refractive index | 1.451 |
40010-99-9 (3r,5s)-3-acetyl-5-butyldihydrofuran-2(3h)-one
service@apichina.com