| Product Name | 3-(trifluoromethyl)thiophenol |
| CAS No. | 937-00-8 |
| Synonyms | 3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
| InChI | InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
| Molecular Formula | C7H5BrClF |
| Molecular Weight | 223.47 |
| Density | 1.618g/cm3 |
| Boiling point | 221.1°C at 760 mmHg |
| Flash point | 87.5°C |
| Refractive index | 1.545 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
937-00-8 3-(trifluoromethyl)thiophenol
service@apichina.com