| Product Name | 3-(trifluoromethyl)phenoxyacetonitrile |
| CAS No. | 2145-31-5 |
| Synonyms | 2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| InChI | InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.1378 |
| Density | 1.309g/cm3 |
| Boiling point | 268.9°C at 760 mmHg |
| Flash point | 116.4°C |
| Refractive index | 1.526 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
service@apichina.com