| Product Name | 3-(styrylthio)propanoic acid |
| CAS No. | 175205-21-7 |
| Synonyms | 3-{[(E)-2-phenylethenyl]sulfanyl}propanoic acid |
| InChI | InChI=1/C11H12O2S/c12-11(13)7-9-14-8-6-10-4-2-1-3-5-10/h1-6,8H,7,9H2,(H,12,13)/b8-6+ |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.2768 |
| Density | 1.21g/cm3 |
| Melting point | 117℃ |
| Boiling point | 393.9°C at 760 mmHg |
| Flash point | 192°C |
| Refractive index | 1.626 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175205-21-7 3-(styrylthio)propanoic acid
service@apichina.com