| Product Name | 3-(phenylthio)acrylic acid, mixture of cis A |
| CAS No. | 63413-91-2 |
| Synonyms | 3-(Phenylthio)acrylic acid,mixture of cis and trans; (2E)-3-(phenylsulfanyl)prop-2-enoic acid |
| InChI | InChI=1/C9H8O2S/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.2236 |
| Density | 1.27g/cm3 |
| Melting point | 102-106℃ |
| Boiling point | 329.4°C at 760 mmHg |
| Flash point | 153°C |
| Refractive index | 1.627 |
63413-91-2 3-(phenylthio)acrylic acid, mixture of cis a
service@apichina.com