| Product Name | (+/-)-3-phenylbutyric acid |
| CAS No. | 4593-90-2 |
| Synonyms | 3-Phenylbutyric acid; 3-phenylbutanoic acid |
| InChI | InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2011 |
| Density | 1.09g/cm3 |
| Melting point | 35-38℃ |
| Boiling point | 288°C at 760 mmHg |
| Flash point | 170.2°C |
| Refractive index | 1.531 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4593-90-2 (+/-)-3-phenylbutyric acid
service@apichina.com