| Product Name | 3-Phenoxybenzaldehyde cyanohydrin |
| CAS No. | 52315-06-7 |
| Synonyms | alpha-Hydroxy-3-phenoxyphenylacetonitrile; hydroxy(3-phenoxyphenyl)acetonitrile |
| InChI | InChI=1/C14H11NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.2426 |
| Density | 1.22g/cm3 |
| Boiling point | 399.8°C at 760 mmHg |
| Flash point | 195.6°C |
| Refractive index | 1.606 |
| Hazard Symbols |  F:Highly flammable;  T:Toxic; |
| Risk Codes | R11:Highly flammable.; R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
52315-06-7 3-phenoxybenzaldehyde cyanohydrin
service@apichina.com