| Product Name | 3-penten-2-one |
| CAS No. | 625-33-2 |
| Synonyms | ethylideneacetone; pent-3-en-2-one; (3E)-pent-3-en-2-one; (3Z)-pent-3-en-2-one |
| InChI | InChI=1/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3- |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.1164 |
| Density | 0.826g/cm3 |
| Boiling point | 122°C at 760 mmHg |
| Flash point | 19.8°C |
| Refractive index | 1.411 |
| Risk Codes | R10:Flammable.; R20/21:Harmful by inhalation and in contact with skin.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
625-33-2 3-penten-2-one
service@apichina.com
- Next:625-34-3 acetoacetaldehyde
- Previous:625-31-0 4-penten-2-ol