| Product Name | 3-(oxiran-2-ylmethoxy)benzaldehyde |
| CAS No. | 22590-64-3 |
| InChI | InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.1846 |
| Density | 1.225g/cm3 |
| Boiling point | 318.2°C at 760 mmHg |
| Flash point | 137.2°C |
| Refractive index | 1.581 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
22590-64-3 3-(oxiran-2-ylmethoxy)benzaldehyde
service@apichina.com