| Product Name | 3-Oxabicyclo[3.1.0]hexane-2,4-dione |
| CAS No. | 5617-74-3 |
| Synonyms | 1,2-Cyclopropanedicarboxylic anhydride |
| InChI | InChI=1/C5H4O3/c6-4-2-1-3(2)5(7)8-4/h2-3H,1H2 |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 112.0835 |
| Density | 1.567g/cm3 |
| Melting point | 59-61℃ |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 143.3°C |
| Refractive index | 1.555 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5617-74-3 3-oxabicyclo[3.1.0]hexane-2,4-dione
service@apichina.com