| Product Name | 3-Octen-2-ol |
| CAS No. | 76649-14-4 |
| Synonyms | FEMA No. 3602; oct-3-en-2-ol; (3E)-oct-3-en-2-ol |
| InChI | InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.212 |
| Density | 0.843g/cm3 |
| Boiling point | 178.8°C at 760 mmHg |
| Flash point | 63.4°C |
| Refractive index | 1.447 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
76649-14-4 3-octen-2-ol
service@apichina.com