| Product Name | 3-O-(2-iodoethyl)glucose |
| CAS No. | 152099-89-3 |
| Synonyms | 3-O-(2-Iodoethyl)glucose; 3-O-(2-Iodoethyl)-D-glucose |
| InChI | InChI=1/C8H15IO6/c9-1-2-15-8(6(13)4-11)7(14)5(12)3-10/h4-8,10,12-14H,1-3H2/t5-,6+,7-,8-/m1/s1 |
| Molecular Formula | C8H15IO6 |
| Molecular Weight | 334.1056 |
| Density | 1.913g/cm3 |
| Boiling point | 556.3°C at 760 mmHg |
| Flash point | 290.3°C |
| Refractive index | 1.603 |
152099-89-3 3-o-(2-iodoethyl)glucose
service@apichina.com