| Product Name | 3-Nonen-2-one |
| CAS No. | 14309-57-0 |
| Synonyms | non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
| InChI | InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.2227 |
| Density | 0.835g/cm3 |
| Boiling point | 201.9°C at 760 mmHg |
| Flash point | 81.3°C |
| Refractive index | 1.435 |
| Risk Codes | R36/37:Irritating to eyes and respiratory system.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
14309-57-0 3-nonen-2-one
service@apichina.com