| Product Name | 3-Nitropyridine |
| CAS No. | 2530-26-9 |
| InChI | InChI=1/C5H4N2O2/c8-7(9)5-2-1-3-6-4-5/h1-4H |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.0975 |
| Density | 1.313g/cm3 |
| Melting point | 38℃ |
| Boiling point | 217°C at 760 mmHg |
| Flash point | 85°C |
| Refractive index | 1.567 |
| Hazard Symbols |  F:Highly flammable;  Xn:Harmful; |
| Risk Codes | R11:Highly flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2530-26-9 3-nitropyridine
service@apichina.com