| Product Name | 3-nitrophthalic acid, compound with pyridine (1:1) |
| CAS No. | 63451-32-1 |
| Synonyms | 1,2-Benzenedicarboxylic acid, 3-nitro-, compd. with pyridine (1:1); Pyridine, 3-nitrophthalic acid salt; Pyridinium 3-nitrophthalate; 3-Nitrophthalic acid, compound with pyridine (1:1); 3-nitrobenzene-1,2-dicarboxylic acid - pyridine (1:1) |
| InChI | InChI=1/C8H5NO6.C5H5N/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13;1-2-4-6-5-3-1/h1-3H,(H,10,11)(H,12,13);1-5H |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.2283 |
| Boiling point | 441.3°C at 760 mmHg |
| Flash point | 199.4°C |
63451-32-1 3-nitrophthalic acid, compound with pyridine (1:1)
service@apichina.com