| Product Name | 3-Nitroformanilide |
| CAS No. | 102-38-5 |
| Synonyms | N-(3-nitrophenyl)formamide |
| InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.1341 |
| Density | 1.407g/cm3 |
| Boiling point | 368.5°C at 760 mmHg |
| Flash point | 176.7°C |
| Refractive index | 1.641 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
102-38-5 3-nitroformanilide
service@apichina.com