| Product Name | 3-Nitrobiphenyl |
| CAS No. | 2113-58-8 |
| Synonyms | 3-Nitrodiphenyl |
| InChI | InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.2054 |
| Density | 1.196g/cm3 |
| Melting point | 56-60℃ |
| Boiling point | 339°C at 760 mmHg |
| Flash point | 161.4°C |
| Refractive index | 1.605 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2113-58-8 3-nitrobiphenyl
service@apichina.com