| Product Name | 3-Nitrobenzhydrazide |
| CAS No. | 618-94-0 |
| Synonyms | 3-nitrobenzohydrazide; m-Nitrobenzhydrazide |
| InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.1488 |
| Density | 1.406g/cm3 |
| Melting point | 153-154℃ |
| Refractive index | 1.621 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
618-94-0 3-nitrobenzhydrazide
service@apichina.com