| Product Name | 3-Nitroacetanilide |
| CAS No. | 122-28-1 |
| Synonyms | m-Nitroacetanilide; 3'-Nitroacetanilide; 3-Nitro-N-acetylaniline; AI3-08832; N-(3-Nitrophenyl)acetamide; N-Acetyl-m-nitroaniline; NSC 1314; Acetamide, N-(3-nitrophenyl)-; Acetanilide, 3'-nitro- (8CI) |
| InChI | InChI=1/C8H8N2O3/c1-6(11)9-7-3-2-4-8(5-7)10(12)13/h2-5H,1H3,(H,9,11) |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.1607 |
| Density | 1.34g/cm3 |
| Boiling point | 379°C at 760 mmHg |
| Flash point | 183°C |
| Refractive index | 1.617 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
122-28-1 3-nitroacetanilide
service@apichina.com