| Product Name | 3-nitro-4-piperidinobenzaldehyde |
| CAS No. | 39911-29-0 |
| Synonyms | 3-nitro-4-piperidin-1-ylbenzaldehyde |
| InChI | InChI=1/C12H14N2O3/c15-9-10-4-5-11(12(8-10)14(16)17)13-6-2-1-3-7-13/h4-5,8-9H,1-3,6-7H2 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.2512 |
| Density | 1.264g/cm3 |
| Melting point | 48℃ |
| Boiling point | 408.6°C at 760 mmHg |
| Flash point | 200.9°C |
| Refractive index | 1.611 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
39911-29-0 3-nitro-4-piperidinobenzaldehyde
service@apichina.com