| Product Name | 3-Nitro-3H-1,5-benzodiazepine |
| CAS No. | 65466-29-7 |
| Synonyms | 3-(Hydroxy(oxido)amino)-3H-1,5-benzodiazepine; NSC 89283 |
| InChI | InChI=1/C9H7N3O2/c13-12(14)7-5-10-8-3-1-2-4-9(8)11-6-7/h1-7H |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.1708 |
| Density | 1.39g/cm3 |
| Boiling point | 432.3°C at 760 mmHg |
| Flash point | 215.2°C |
| Refractive index | 1.673 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
65466-29-7 3-nitro-3h-1,5-benzodiazepine
service@apichina.com