| Product Name | 3-n-Pentadecylphenol |
| CAS No. | 501-24-6 |
| Synonyms | Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
| InChI | InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.5099 |
| Density | 0.908g/cm3 |
| Melting point | 47-53℃ |
| Boiling point | 402°C at 760 mmHg |
| Flash point | 246.3°C |
| Refractive index | 1.495 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
501-24-6 3-n-pentadecylphenol
service@apichina.com