| Product Name | 3-morpholino-4-tetrahydro-1H-pyrrol-1-ylcyclobut-3-ene-1,2-dione |
| CAS No. | 282093-48-5 |
| Synonyms | 3-morpholin-4-yl-4-pyrrolidin-1-ylcyclobut-3-ene-1,2-dione |
| InChI | InChI=1/C12H16N2O3/c15-11-9(13-3-1-2-4-13)10(12(11)16)14-5-7-17-8-6-14/h1-8H2 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.267 |
| Density | 1.398g/cm3 |
| Melting point | 251℃ |
| Boiling point | 359.9°C at 760 mmHg |
| Flash point | 171.4°C |
| Refractive index | 1.629 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
282093-48-5 3-morpholino-4-tetrahydro-1h-pyrrol-1-ylcyclobut-3-ene-1,2-dione
service@apichina.com